Tính toán kết cấu thép cần trục bánh xích 63 tấn

KẾT CẤU THÉP CẦN TRỤC BÁNH XÍCH 63 TẤN I). Giới thiệu chung Kết cấu thép của máy trục là một nhân tố quan trọng trong hoạt động lâu dài ở ngoài trời: chụi tải trọng gió, bảo và các tải trọng khác. Kết cấu thép là phần chụi tải để các cơ cấu maý làm việc bình thường. Trong các máy trục, kết cấu kim loại chiếm 1 phần kim loai rất lớn. Khối lượng kim loại dùng cho kết cấu cần chiếm 60% - 80% khối lượng toàn bộ máy trục. Vì thế việc chọn kết cấu cần thích hợp cho kết cấu cần để sử dụng một cách kinh tế là quan trọng nhất. Kết cấu cần của máy trục thường sử dụng thép định hình như thép ống, thép gốc hay thép tấm được nối với nhau bằng hàn hay đinh tán. Các loại thép này được chế tao bằng thép cacbon, thép hợp kim thấp hay bằng hợp kim nhôm. 1).Giới thiệu về kết cấu thép cần trục thiết kế: Kết cấu cần gồm 1 tay cần cơ bản được liên kết với cần trục qua 2 khớp bản lề. Tay cần lúc nào cũng nằm trên cần trục ngay cả khi di chuyển. Còn những đoạn tay cầm còn lại sẽ nằm bên ngoài và khi cần dùng trong những phạm vi khác nhau thì sẻ dung các đoạn cần đó. Các đoạn tay cần này được nối với tay cần cơ bản bằng các chốt. Do kết cấu tay cần như vậy nên cần có thêm một thiết bị để gắn các cụm puly, vị trí treo cáp nâng cần và đồng thời chịu 1 phần lực tác dụng lên các thanh bụng. Việc nghiên cứu tính toán ứng dụng kết cấu thép của máy có liên quan đến các ngành khoa học khác như: sức bền vật liệu, cơ học lý thuyết, công nghệ hàn . mặt khác kết cấu thép là phần chiếm nhiều kim loại nhất trong toàn bộ máy trục, vì thế để có khối lượng máy trục hợp lý cần phải thiết kế vả tính toán phần kim loại của nó. Ngoài việc đảm bảo độ bền khi làm việc, kết cấu kim loại phải dễ gia công, chế tạo, đẹp và có giá thành tương đối, dễ bảo quản sửa chữa. 2. Các thông số cơ bản C¸c kÝch th­íc vỊ chiỊu dµi cÇn ®­ỵc x¸c ®Þnh th«ng qua s liªn hƯ h×nh hc ®Ĩ ®¶m b¶o viƯc cÇn trơc c thĨ xp dì ®­ỵc hµng trong tÇm víi cho phÐp. ChiỊu dµi cÇn Lc =15m Khi tÝnh to¸n kt cu thÐp ta x¸c ®Þnh t¹i 3 vÞ tri tÇm víi ng víi gc nghiªng nh­ sau: · Rmax = 14,5 m =150 Q = 12,2T =11,70 = 50 · Rtb = 8,6 m =550 Q = 34T =49,80 =350 · Rmin = 4, 5m =800 Q = 63T =700 =620 3. Hình thức kết cấu. Cần trục bánh xích CK là loại cần trục quay thay đổi tầm với bằng cách nâng hạ cần. Cần là một dàn có trục thẳng, tiết diện thay đổi theo chiều dài cần. Phần dưới của cần đặt trên bản lề cố định trên phần quay của kết cấu kim loại, đầu trên nối với palăng thay đổi tầm với. Vì thế cần được xem như một thanh đặt trên hai bản lề. Đối với các cần trục có trọng tải lớn cần được chế tạo kiểu dàn với tiết diện ngang tứ giác. Thanh biên của các tứ giác đó được làm bằng thép góc. Để giảm nhẹ trọng lượng, cần được chế tạo theo kiểu dàn có độ cứng thay đổi. 4).Các thông số cơ bản của kết cấu thép cần: ChiỊu cao cđa dàn ®ng chÝnh gi÷a nhÞp. Ly H=1200 (mm) ChiỊu dµi ®o¹n nghiªng C = 5m ly theo m¸y mu. BỊ rng mỈt ngang cđa dàn b = 1200 mm Khoảng cách giữa hai điệm tựa ở đầu dưới cần lấy trong khoảng: II). Các trường hợp tải trọng : Khi máy trục làm việc nó chịu nhiều loại tải trọng khác nhau tác dụng lên kết cấu: tải trọng cố định, tải trọng không di động, tải trọng quán tính theo phương thẳng đứng hay nằm ngang, tải trọng gió, tải trọng do lắc động hàng trên cáp, . Khi tính thiết kế kết cấu kim loại máy trục của cần trục người ta tính toán theo 3 trường hợp sau: 1. Trường hợp tải trọng I: Các tải trọng tiêu chuẩn tác dụng lên máy trục ở trạng thái làm việc bình thường. Dùng để tính toán kết cấu kim loại theo độ bền lâu. Các tải trọng thay đổi được tính quy đổi thành tải trọng tương đương. 2. Trường hợp tải trọng II: Các tải trọng lớn nhất phát sinh khi máy trục làm việc ở chế độ chịu tải nặng nề. Dùng để tính toán kết cấu kim loại theo điều kiện bền và điều kiện ổn định. 3. Trường hợp tải trọng III: Máy trục không làm việc nhưng chịu tác dụng của các tải trọng phát sinh lớn nhất. Ví dụ: Trọng lượng bản thân, trọng lượng gió (bão), trường hợp này dùng để kiểm tra kết cấu theo độ, bền độ ổn định. Ở trạng thái làm việc của cần trục người ta tổ hợp các tải trọng tác dụng lên máy trục và chia ra thành các tổ hợp tải trọng sau: +).Tổ hợp Ia, IIa: tương ứng với trạng thái cần trục làm việc, cần trục đứng yên chỉ có một cơ cấu nâng làm việc, tính toán khi khởi động (hoặc hãm) cơ cấu nâng hàng, khởi động một cách từ từ tính cho Ia; khởi động (hãm) một cách đột ngột tính cho tổ hợp IIa. +).Tổ hợp Ib, IIb: máy trục di chuyển có mang hàng đồng thời lại có thêm một cơ cấu khác đang hoạt động (di chuyển xe con, di chuyển xe tời, quay, thay đổi tầm với), tiến hành khởi động (hoặc hãm) cơ cấu đó một cách từ từ tính cho tổ hợp Ib; đột ngột IIb. Kết cấu kim loại của cần chịu tải trọng nặng nề nhất tương đương với tập hợp tải trọng IIa. Khi cần trục đứng yên tiến hành nâng hàng từ mặt nền ở vị trí bất lợi nhất và tiến hành hãm hàng khi nâng phối hợp với chuyển động quay (các tải trọng tính gồm có: tải trọng không di động tính + tải trọng tạm thời tính khi treo trọng tải lớn nhất ở tầm với lớn nhất + lực quán tính ngang + tải trọng gió ở trạng thái làm việc). Do đó ta sử dụng trường hợp tải trọng IIa để tính kết cấu kim loại của cần. III).Tỉ hỵp t¶i trọng vµ bảng tổ hợp tảii trọng: 1. Tỉ hỵp T¶i trng: Theo yªu cÇu thit k cÇn trơc vỊ ® bỊn vµ ® ỉn ®Þnh, do vy ta tÝnh cho lo¹i cÇn trơc di chuyĨn b¸nh xÝch ng víi tr­ng t¶i trngIIa, IIb. Để tÝnh kt cu kim lo¹i m¸y trơc ta dng ph­¬ng ph¸p ng sut cho phÐp, theo công thức: a).Tỉ hỵp T¶i trng IIa: t­¬ng ng khi cÇn trơc ®ng yªn tin hµnh n©ng, h¹ mt c¸ch ®t ngt. b).Tỉ hỵp T¶i trng IIb: cÇn trơc di chuyĨn c mang hµng h·m ®t ngt. 2. Bảng tải trọng tính toán: Loại tải trọng Các trường hợp tải trọng IIa IIb III Trọng lượng bản thân cần, có tính đến hệ số va đập Trọng lượng hàng Q (kể cả thiết bị mang hàng) tính đến hệ số động khi nâng Lực căng trong cáp treo hàng Lực quán tính ngang do trong lượng kết cấu xuất hiện khi mở máy hoặc phanh cơ cấu Lực quán tính ngang do trọng lượng hàng cùng thiết bị mang Tải trọng gió tác dụng lên kết cấu IV). Các tải trọng tính toán: 1 ).Trường hợp tải trọng IIa: Khi tính kết cấu kim loại cần của cần trục cần biết tất cả các loại tải trọng tác dụng lên nó như: tải trọng không di động, tải trọng tạm thời, lực quán tính, tải trọng gió, đồng thời lực trong dây cáp treo vật và dây cáp treo cần. a ).Trong mặt phẳng nâng hạ Gồm những phần riêng lẻ của kết cấu kim loại cần. Vì đây là loại cần lớn tải trọng do trọng lượng bản thân cần được xem như phân bố dọc theo chiều dài của cần, theo công thức (8.48) [1]: Gc = qcl

doc69 trang | Chia sẻ: lvcdongnoi | Ngày: 10/06/2013 | Lượt xem: 1648 | Lượt tải: 5download
Bạn đang xem nội dung tài liệu Tính toán kết cấu thép cần trục bánh xích 63 tấn, để tải tài liệu về máy bạn click vào nút DOWNLOAD ở trên
ieäc vaø khoâng laøm vieäc ñaët phaân boá ñeàu ôû caùc maét cuûa daøn ngang. Taûi troïng gioù phaân boá ñeàu pg treân maët I cuûa daøn, theo coâng thöùc: Pg = qo.n.c.g.b Trong ñoù: ® qo: aùp löïc ñoäng cuûa gioù ôû ñoä cao 10 (m) so vôùi maët ñaát, ñoái vôùi: + Traïng thaùi laøm vieäc: qo = 25 KG/m2. + Traïng thaùi khoâng laøm vieäc: qo = 40 KG/m2. ® n: heä soá ñieàu chænh taêng aùp löïc phuï thuoäc vaøo ñoä cao so vôùi maët ñaát, tra baûng 1.6 [9] choïn n = 1. ® c: heä soá khí ñoäng hoïc, tra baûng 4.6 choïn c = 1,5. ® g: heä soá quaù taûi (tính theo phöông phaùp öùng suaát cho pheùp g = 1). ® b: heä soá ñoäng löïc, do ñaëc tính maïch ñoäng cuûa aùp suaát ñoäng cuûa gioù. Khi tính nhöõng chi tieát maùy truïc theo ñoä beàn chaéc: b = 1,5 Vaäy: + ÔÛû traïng thaùi laøm vieäc: Pg = 253131,53131,5 = 56 (KG/m2) + ÔÛ traïng thaùi khoâng laøm vieäc: Pg = 403131,53131,5 = 90 (KG/m2) · Toaøn boä taûi troïng gioù taùc duïng leân caàn, coâng thöùc: Wc = Pg 3Fc Fc: dieän tích chaén gioù cuûa caàn. Fc = 5,6 cm2 Do ñoù toaøn boä taûi troïng gioù taùc duïng leân caàn: + ÔÛ traïng thaùi laøm vieäc: Wc = 5635,6 = 313 (Kg). + ÔÛ traïng thaùi khoâng laøm vieäc: Wc = 5635,6 = 504 (Kg). Taûi troïng gioù phaân boá ñeàu treân maët I cuûa caàn : + ÔÛ traïng thaùi laøm vieäc: + ÔÛ traïng thaùi khoâng laøm vieäc: · Taûi troïng gioù taùc duïng leân haøng, theo coâng thöùc (1.16) [9]: Wh = Pg3Fh Trong ñoù: ® vh: taûi troïng gioù phaân boá ñeàu treân haøng baèng taûi troïng gioù taùc duïng caàn ôû traïng thaùi laøm vieäc. ® Fh: dieän tích maët chòu gioù cuûa haøng, theo baûng 1.8 [1]: Rmax : Q =12,2T Þ Fh = 10 m2 Þ Wh = 56310 = 560 (Kg) Rtb : Q = 34T Þ Fh = 20m2 Þ Wh = 56320 = 1120 (Kg) Rmin : Q = 25T Þ Fh = 30m2 Þ Wh = 56330 = 1680 (Kg). +). Löïc quaùn tính ngang do troïng löôïng cuûa keát caáu: Xuaát hieän khi môû maùy hay khi phanh cô caáu quay. Caùc löïc naøy laáy baèng 0,1 cuûa caùc taûi troïng thaúng ñöùng (khoâng keå ñeán heä soá k1), theo coâng thöùc: Gng = 0,13G1 = 0,133 = 0,3 (T) = 300 (Kg) Vì ñaây laø loaïi caàn lôùn neân löïc quaùn tính ngang phaân boá doïc theo chieàu daøi caàn hay laø ñaët vaøo caùc maét cuûa daøn ngang: +).Löïc quaùn tính ngang do troïng löôïng cuûa vaät naâng vaø boä phaän mang vaät: Cuõng xuaát hieän khi môû maùy hay khi phanh cô caáu quay. Löïc naøy baèng 0,1 troïng löôïng cuûa vaät naâng vaø boä phaän mang vaät vaø ñaët ôû ñieåm noái caùc roøng roïc ñaàu caàn theo coâng thöùc: Png = 0,1(Q + G3) ÔÛ taàm vôùi lôùn nhaát Rmax: Png = 0,13(6100 + 618) = 672 (Kg). ÔÛ taàm vôùi trung bình Rtb:Png = 0,13(17000 + 618) = 1762 (Kg). ÔÛ taàm vôùi nhoû nhaát Rmin:Png = 0,13(31500 + 618) = 3211 (Kg). + Trong maët phaúng vuoâng goùc vôùi maët phaúng naâng caàn: q = 20 + 20,86= 40,86 (Kg) + ÔÛ taàm vôùi lôùn nhaát: Png = 672(Kg) ; Wh = 560 (Kg). L = 15m Þ + ÔÛ taàm vôùi trung bình: Png = 1762(Kg) ; Wh = 680(Kg). L = 15m Þ + ÔÛ taàm vôùi nhoû nhaát: Png = 3211 (Kg) ; Wh = 1020 (Kg). L = 15m Þ Phaûn löïc töïa ngang döôùi taùc duïng cuûa moâmen töïa toång do caùc taûi troïng ngang sinh ra Mng laø moät caëp löïc ñöôïc tính theo coâng thöùc (8.63) [1]: * ÔÛ taàm vôùi lôùn nhaát: * ÔÛ taàm vôùi trung bình: * ÔÛ taàm vôùi nhoû nhaát: Trong ñoù: ® bo: khoaûng caùch giöõa hai taâm baûn leà bo = 1,2m.(maùy maãu) 3)Bieåu ñoà noäi löïc döôùi taùc duïng cuûa troïng löôïng baûn thaân caàn: M = ; ; Rmax: M = 5433(Kg.m) Rtb: M = 3226(Kg.m) Rmin: M = 490(Kg.m) Q = 1448 (Kg). Q = 860 (Kg). Q = 130 (Kg) N = 388 (Kg). N = 1229 (Kg). N = 1494 (Kg). V- Xaùc ñònh noäi löïc caùc thanh trong daøn: 1).Khaùi nieäm: Daøn laø moät heä goàm nhieàu thanh thaúng noái vôùi nhau baèng nhöõng khôùp. Ñeå taêng ñoä chính xaùc cuûa pheùp tính, noäi löïc trong caùc thanh caàn ñöôïc xaùc ñònh theo heä khoâng gian. Tuy nhieân ñeå ñôn giaûn hôn trong caùc pheùp tính ta coù theå chia heä khoâng gian ra nhieàu heä phaúng vaø moãi heä phaúng naøy ñaët döôùi taùc duïng cuûa caùc heä löïc trong maët phaúng töông öùng. Giao ñieåm cuûa caùc thanh trong daøn goïi laø maét. Khoaûng caùch giöõa caùc maét thuoäc cuøng moät ñöôøng bieân goïi laø ñoát. Thanh taïo thaønh chu vi cuûa daøn ôû phía treân goïi laø thanh bieân treân, ôû phía döôùi goïi laø thanh bieân döôùi. Ngoaøi ra coøn coù caùc thanh giaèng cheùo: Ñeå tính daøn ñöôïc ñôn giaûn ta thöøa nhaän giaû thieát sau: Maét cuûa daøn phaûi naèm taïi giao ñieåm cuûa caùc truïc thanh vaø ñöôïc xem laø khôùp lyù töôûng. Taûi troïng chæ taùc duïng taïi maét cuûa daøn. Troïng löôïng baûn thaân cuûa thanh khoâng ñaùng keå so vôùi taûi troïng taùc duïng leân daøn. Töø caùc giaû thieát treân ta thaáy caùc thanh trong daøn chæ chòu löïc keùo hoaëc neùn nghóa laø chòu löïc doïc truïc maø khoâng coù moâmen uoán. 2). Tính noäi löïc trong daøn baèng phöông phaùp taùch maét a).Tröôøng hôïp taûi troïng IIa +) Tính caàn trong maët phaúng naâng haï caàn: Caùc löïc taùc duïng leân caàn goàm coù: troïng löôïng cuûa haøng vaø thieát bò mang haøng, troïng löôïng baûn thaân caàn, löïc caêng caùp naâng caàn vaø naâng haøng. Trong maët phaúng thaûng ñöùng caàn chuïi taùc duïng cuûa troïng löôïng baûn thaân caàn. Ta xem nhö laø taûi troïng phaân boá leân caùc maét cuûa daøn. Coù 35 maét neân moái maét seû chòu löïc laø: (Kg). Taùch maét 1. å X = 0 Þ N1.cos(+7) + N2.cos(-7) + Rh = 0 å Y = 0 Þ N1.sin(+7) + N2.sin(-7) + Rv –Pc = 0 ÔÛ taàm vôùi lôùn nhaát. N1 = - 26782 N2 = -15689 Kg ÔÛ taàm vôùi trung bình. N1 = - 33440 N2 = -23407 Kg ÔÛ taàm vôùi nhoû nhaát. N1 = - 42458 N2 = -11726 Kg Taùch maét 2. å X = 0 Þ -N2.cos(-7) + N4.cos(-7) = 0 å Y = 0 Þ N2.sin(-7) + sin(-7) + N3 – Pc = 0 ÔÛ taàm vôùi lôùn nhaát. N3 = 4452 N4 = -15689 Kg ÔÛ taàm vôùi trung bình. N3 = 34140 N4 = -23407 Kg ÔÛ taàm vôùi nhoû nhaát. N3 = 11128 N4 = -11726 Kg Taùch maét 3. å X = 0 Þ N5.cos(+7) + N6.cos(-20)-N1.cos(+7) = 0 å Y = 0 Þ N5.sin(+7) + N6.sin(-20)-N1.sin(+7)-Pc = 0 ÔÛ taàm vôùi lôùn nhaát. N5 = -16808 N6 = -9287 Kg ÔÛ taàm vôùi trung bình. N5 = -23353 N6= -7308 Kg ÔÛ taàm vôùi nhoû nhaát. N5 = -30109 N6 = -1312 Kg Taùch maét 4. å X = 0 Þ N7.cos(+31) + N8.cos(-7)-N6.cos(-20)-N4.cos(-7) = 0 å Y = 0 Þ N7.sin(+31) + N8.sin(-7)-N6.sin(-20)- N4.sin(-7)-Pc = 0 ÔÛ taàm vôùi lôùn nhaát. N7 = 943 N8 = -24376 Kg ÔÛ taàm vôùi trung bình. N7 = 1777 N8= -22132 Kg ÔÛ taàm vôùi nhoû nhaát. N7 = 5321 N8 = -19328 Kg Taùch maét 5. å X = 0 Þ N9.cos(+31) + N10.cos(-40)-N5.cos(+7)-N7.cos(+31) = 0 å Y = 0 Þ N9.sin(+31) - N10.sin(-40)-N5.(+7)-N7.cos(+31)-Pc = 0 ÔÛ taàm vôùi lôùn nhaát. N9 = -17321 Kg N10 = -8342 Kg ÔÛ taàm vôùi trung bình. N9 = -24345 Kg N10 = -5231 Kg ÔÛ taàm vôùi nhoû nhaát. N9= -31784 Kg N10 = -1947 Kg Taùch maét 6. å X = 0 Þ N11.cos(+47) + N12.cos(-7)-N10.cos(+33)-N8.cos(-7) = 0 å Y = 0 Þ N11.sin(+47) - N12.sin(-7)+N10.(+33)+N8.sin(-7)-Pc = 0 ÔÛ taàm vôùi lôùn nhaát. N11 = 1511 Kg N12 = -31654 Kg ÔÛ taàm vôùi trung bình. N11 = 6783 Kg N12 = -27433 Kg ÔÛ taàm vôùi nhoû nhaát. N11 = 7332 Kg N12 = -21258 Kg Taùch maét 7. å X = 0 Þ N13.cos(+7) + N14.cos(-53)-N9.cos(+7)-N11.cos(+40) = 0 å Y = 0 Þ N13.sin(+7) - N14.sin(-53)-N9.(+33)-N11.sin(+40)-Pc = 0 ÔÛ taàm vôùi lôùn nhaát. N13 = -12125 Kg N14 = -10135 Kg ÔÛ taàm vôùi trung bình. N13 = -28137 Kg N14 = -3478 Kg ÔÛ taàm vôùi nhoû nhaát. N13 = -32339 Kg N14 = -938 Kg Taùch maét 8 å X = 0 Þ N15.cos(+57) + N16.cos(+7)-N14.cos(-53)-N12.cos(-7) = 0 å Y = 0 Þ N15.sin(+57) - N16.sin(+7)+N14.(-53)+N12.sin(-7)-Pc = 0 ÔÛ taàm vôùi lôùn nhaát. N15 = 2398Kg N16 = -31122 Kg ÔÛ taàm vôùi trung bình. N15 = 4532Kg N16 = -23487 Kg ÔÛ taàm vôùi nhoû nhaát. N15 = 9131Kg N16 = -16431 Kg Taùch maét 9. å X = 0 Þ N17.cos(+7) + N18.cos(-67)-N13.cos(+7)-N15.cos(+57) = 0 å Y = 0 ÞN17.sin(+7) - N18.sin(-67)-N13.sin(+7)-N15.sin(+57)-Pc = 0 ÔÛ taàm vôùi lôùn nhaát. N17 = -13141 Kg N18= -8751 Kg ÔÛ taàm vôùi trung bình. N17 = -28135 Kg N18 = -6325 Kg ÔÛ taàm vôùi nhoû nhaát. N17 = -34322 Kg N18 = -802 Kg Taùch maét 10. å X = 0 Þ N19.cos(+63) + N20.cos(-7)-N18.cos(-61)-N16.cos(-7) = 0 å Y = 0 Þ N19.sin(+63) – N20.sin(+7)+N18.(-61)+N16.sin(-7)-Pc = 0 ÔÛ taàm vôùi lôùn nhaát. N19 = 1232Kg N20= -28891 Kg ÔÛ taàm vôùi trung bình. N19 = 5368Kg N20 = -21743 Kg ÔÛ taàm vôùi nhoû nhaát. N19 = 9739Kg N20 = -11738 Kg Taùch maét 11. å X = 0 Þ N21.cos(+7) + N22.cos(-64)-N17.cos(+7)-N19.cos(+64) = 0 å Y = 0 Þ N21.sin(+7) – N22.sin(-64)-N17.sin(+7)-N19.sin(+64)-Pc = 0 ÔÛ taàm vôùi lôùn nhaát. N21 = -13742 Kg N22= -11418 Kg ÔÛ taàm vôùi trung bình. N21 = -19432Kg N22 = -7132 Kg ÔÛ taàm vôùi nhoû nhaát. N21 = -28743Kg N22 = -4568 Kg Taùch maét 12. å X = 0 Þ N24 - N21.cos(+7) = 0 å Y = 0 Þ -N23 - Pc – N21.sin(+7) = 0 ÔÛ taàm vôùi lôùn nhaát. N23 = 5062 Kg N24 = -12741 Kg ÔÛ taàm vôùi trung bình. N23= 17249 Kg N24 = -91222 Kg ÔÛ taàm vôùi nhoû nhaát. N23 = 28618 Kg N24 = -4213 Kg Taùch maét 13. å X = 0 Þ N26 + N25.cos(+66) - N22.cos(-66) - N20.cos(-7) = 0 å Y = 0 Þ N25.sin(+66) + N23 + N22.sin(-66) + N20.sin(-7) = 0 ÔÛ taàm vôùi lôùn nhaát. N25 = -9678 Kg N26 = -37517 Kg ÔÛ taàm vôùi trung bình. N25 = -2366 Kg N26 = -26432Kg ÔÛ taàm vôùi nhoû nhaát. N25 = - 1432Kg N26 = -21327Kg Taùch maét 14. å X = 0 Þ N27 –N24+ N28.cos(-67) - N25.cos(+67) = 0 å Y = 0 Þ - N28.sin(-67) - N25.sin(+67) - Pc = 0 ÔÛ taàm vôùi lôùn nhaát. N28 = 12259Kg N27 = -30124 Kg ÔÛ taàm vôùi trung bình. N28 = 9241Kg N27 = -24123Kg ÔÛ taàm vôùi nhoû nhaát. N28 = 4139Kg N27 = -18312 Kg Taùch maét 15. å X = 0 Þ N30 + N26 - N28.cos(-67) - N29.cos(+67) = 0 å Y = 0 Þ N29.sin(+67) + N28.sin(-67) - Pc = 0 ÔÛ taàm vôùi lôùn nhaát. N30 = -28623 Kg N29 = -9669 Kg ÔÛ taàm vôùi trung bình. N30 = -18531Kg N29 = -2165 Kg ÔÛ taàm vôùi nhoû nhaát. N30 = -15571 Kg N29 = -1541 Kg Taùch maét 16. å X = 0 Þ N31 –N27 - N32.cos(-67) - N29.cos(+67) = 0 å Y = 0 Þ -N32.sin(-67) - N29.sin(-67) - Pc = 0 ÔÛ taàm vôùi lôùn nhaát. N32 = 11348 Kg N31 = -17312 Kg ÔÛ taàm vôùi trung bình. N32 = 8735 Kg N31 = -21831 Kg ÔÛ taàm vôùi nhoû nhaát. N32 = 4088 Kg N31 = -27635 Kg Taùch maét 17. å X = 0 Þ N34 –N30 - N32.cos(-67) + N33.cos(+67) = 0 å Y = 0 Þ N33.sin(+67) + N32.sin(-67) - Pc = 0 ÔÛ taàm vôùi lôùn nhaát. N33 = - 8541 Kg N34 = -26135 Kg ÔÛ taàm vôùi trung bình. N33 = - 3230 Kg N34 = -17421Kg ÔÛ taàm vôùi nhoû nhaát. N33 = -1837 Kg N34 = -14321 Kg Taùch maét 18. å X = 0 Þ N35 –N31 - N33.cos(-67) + N36.cos(+67) = 0 å Y = 0 Þ -N36.sin(-67) – N33.sin(+67) - Pc = 0 ÔÛ taàm vôùi lôùn nhaát. N35 = - 17121 Kg N36 = 10318 Kg ÔÛ taàm vôùi trung bình. N35 = -22318 Kg N36 = 8213 Kg ÔÛ taàm vôùi nhoû nhaát. N35 = -27134 Kg N36 = 3905 Kg Taùch maét 19. å X = 0 Þ N38 –N34 - N37.cos(+67) + N36.cos(-67) = 0 å Y = 0 Þ N37.sin(+67) + N36.sin(-67) - Pc = 0 ÔÛ taàm vôùi lôùn nhaát. N38 = -26022 Kg N37 = -8132 Kg ÔÛ taàm vôùi trung bình. N38 = -17318 Kg N37 = -4312Kg ÔÛ taàm vôùi nhoû nhaát. N38 = -13981Kg N37 = -2231 Kg Taùch maét 20. å X = 0 Þ N39 –N35 - N40.cos(-67) + N37.cos(+67) = 0 å Y = 0 Þ -N40.sin(-67) – N37.sin(+67) - Pc = 0 ÔÛ taàm vôùi lôùn nhaát. N39 = -16987 Kg N40= 10019 Kg ÔÛ taàm vôùi trung bình. N39 = -21385 Kg N40 = 7399 Kg ÔÛ taàm vôùi nhoû nhaát. N39 = -27003 Kg N40= 3887 Kg Taùch maét 21. å X = 0 Þ N42 –N38 + N41.cos(+67) + N40.cos(-67) = 0 å Y = 0 Þ N37.sin(+67) + N36.sin(-67) - Pc = 0 ÔÛ taàm vôùi lôùn nhaát. N41 = -7873 Kg N42 = -25319 Kg ÔÛ taàm vôùi trung bình. N41= -4228 Kg N42 = -16989 Kg ÔÛ taàm vôùi nhoû nhaát. N41 = -2047 Kg N42 = -13035 Kg Taùch maét 22. å X = 0 Þ N43 –N39 - N41.cos(+67) + N44.cos(-67) = 0 å Y = 0 Þ -N44.sin(-67) – N41.sin(+67) - Pc = 0 ÔÛ taàm vôùi lôùn nhaát. N43 = -16987 Kg N44 = 9875 Kg ÔÛ taàm vôùi trung bình. N43 = -20318 Kg N44 = 7039 Kg ÔÛ taàm vôùi nhoû nhaát. N43 = -26312 Kg N44 = 3412 Kg Taùch maét 23. å X = 0 Þ N46.cos(-7) – N43 = 0 å Y = 0 Þ -N46.sin(-7) – N45 – Pc = 0 ÔÛ taàm vôùi lôùn nhaát. N45 = 2191 Kg N46 = -16357 Kg ÔÛ taàm vôùi trung bình. N45 = 22479 Kg N46 = -30364 Kg ÔÛ taàm vôùi nhoû nhaát. N45 = 36172 Kg N46 = -38123 Kg Taùch maét 24. å X = 0 Þ N47.cos(+66) + N48.cos(+7) – N44.cos(-66) - N42 = 0 å Y = 0 Þ N47.sin(+66) + N48.sin(+7) + N44.sin (-66) + N45-Pc = 0 ÔÛ taàm vôùi lôùn nhaát. N47 = 8226 Kg N48 = -36311 Kg ÔÛ taàm vôùi trung bình. N47 = 12570 Kg N48 = -38015 Kg ÔÛ taàm vôùi nhoû nhaát. N47 = 14411 Kg N48 = -40132 Kg Taùch maét 25. å X = 0 Þ N49.cos(-7) + N50.cos(-64) – N46.cos(-7)-N47.cos(+66) = 0 å Y = 0 Þ-N49.sin(-7) - N50.sin(-64) +N46.sin(-7)-N47.sin(+66)-Pc = 0 ÔÛ taàm vôùi lôùn nhaát. N49 = -37151 Kg N50 = -12541 Kg ÔÛ taàm vôùi trung bình. N49 = -30387 Kg N50 = -10783 Kg ÔÛ taàm vôùi nhoû nhaát. N49 = -26415 Kg N50 = -7031 Kg Taùch maét 26. å X = 0 Þ N52.cos(+7) + N51.cos(+61) – N50.cos(-63)-N48.cos(+7) = 0 å Y = 0 ÞN52.sin(+7) + N51.sin(-64) +N50.sin(-63)-N48.sin(+7)-Pc = 0 ÔÛ taàm vôùi lôùn nhaát. N51 = 7132 Kg N52 = -31751 Kg ÔÛ taàm vôùi trung bình. N51 = 11314 Kg N52 = -34483 Kg ÔÛ taàm vôùi nhoû nhaát. N51 = 13435 Kg N52 = -36148 Kg Taùch maét 27. å X = 0 Þ N53.cos(-7) + N54.cos(-57) – N49.cos(-7)-N51.cos(+61) = 0 å Y = 0 Þ-N53.sin(-7) – N54.sin(-57) +N49.sin(-7)-N51.sin(+61)-Pc = 0 ÔÛ taàm vôùi lôùn nhaát. N53 = -34321 Kg N54 = -12008 Kg ÔÛ taàm vôùi trung bình. N53 = -28739 Kg N54 = -9913 Kg ÔÛ taàm vôùi nhoû nhaát. N53 = -22987 Kg N54 = -6548 Kg Taùch maét 28. å X = 0 Þ N55.cos(+53) + N56.cos(+7) – N52.cos(+7)-N54.cos(-57) = 0 å Y = 0 ÞN55.sin(+53) + N56.sin(+7) -N52.sin(+7)+N54.sin(-57)-Pc = 0 ÔÛ taàm vôùi lôùn nhaát. N55 = 6973 Kg N56 = -29711 Kg ÔÛ taàm vôùi trung bình. N55 = 10759 Kg N56 = -31435 Kg ÔÛ taàm vôùi nhoû nhaát. N55 = 12312 Kg N56 = -33258 Kg Taùch maét 29. å X = 0 Þ N57.cos(-7) + N58.cos(-40) – N53.cos(-7)-N55.cos(+53) = 0 å Y = 0 Þ-N57.sin(-7) – N58.sin(-40) +N53.sin(-7)-N55.sin(+53)-Pc = 0 ÔÛ taàm vôùi lôùn nhaát. N57 = -31059 Kg N58 = -11145 Kg ÔÛ taàm vôùi trung bình. N57 = -25432 Kg N58 = -8198 Kg ÔÛ taàm vôùi nhoû nhaát. N57 = -20793 Kg N58 = -5451 Kg Taùch maét 30. å X = 0 Þ N60.cos(+7) + N59.cos(+33) – N58.cos(-47)-N56.cos(+7) = 0 å Y = 0 ÞN60.sin(+7) + N59.sin(+33) +N58.sin(-47)-N56.sin(+7)-Pc = 0 ÔÛ taàm vôùi lôùn nhaát. N59 = 6033 Kg N60 = -25521 Kg ÔÛ taàm vôùi trung bình. N59 = 9347 Kg N60 = -27185 Kg ÔÛ taàm vôùi nhoû nhaát. N59 = 11258 Kg N60 = -30177 Kg Taùch maét 31. å X = 0 Þ N61.cos(-7) + N62.cos(-31) – N57.cos(-7)-N59.cos(+40) = 0 å Y = 0 Þ-N61.sin(-7) – N562.sin(-31) +N57.sin(-7)-N59.sin(+40)-Pc = 0 ÔÛ taàm vôùi lôùn nhaát. N61 = -29753 Kg N62 = -9761 Kg ÔÛ taàm vôùi trung bình. N61 = -22318 Kg N62 = -6532 Kg ÔÛ taàm vôùi nhoû nhaát. N61 = -16587 Kg N62 = -3411 Kg Taùch maét 32. å X = 0 Þ N64.cos(+7) + N63.cos(+20) – N62.cos(-31)-N60.cos(+7) = 0 å Y = 0 ÞN64.sin(+7) + N63.sin(+33) +N62.sin(-31)-N60.sin(+7)-Pc = 0 ÔÛ taàm vôùi lôùn nhaát. N63 = 5178 Kg N64 = -20786 Kg ÔÛ taàm vôùi trung bình. N63 = 8132 Kg N64 = -22187 Kg ÔÛ taàm vôùi nhoû nhaát. N63 = 9030 Kg N64 = -24121 Kg Taùch maét 33. å X = 0 Þ N66.cos(+7) N64.cos(+7) = 0 å Y = 0 ÞN66.sin(+7) + N65 -N64.sin(+7)-Pc = 0 ÔÛ taàm vôùi lôùn nhaát. N66 = -20786 Kg N65 = 12385 Kg ÔÛ taàm vôùi trung bình. N66 = -22187 Kg N65= 9783 Kg ÔÛ taàm vôùi nhoû nhaát. N66 = -24121 Kg N65 = 2030 Kg Taùch maét 34. å X = 0 Þ N67.cos(-7) - N62.cos(-7)-N63.cos(+20) = 0 ÔÛ taàm vôùi lôùn nhaát. N67 = -10853 Kg ÔÛ taàm vôùi trung bình. N67 = -12187 Kg ÔÛ taàm vôùi nhoû nhaát. N67 = -13428 Kg Taùch maét 35. å Y = 0 Þ N67.sin(-7) - N62.sin(+7)-Pc= 0 ÔÛ taàm vôùi lôùn nhaát. N68 = 9239Kg ÔÛ taàm vôùi trung bình. N68 = -11324 Kg ÔÛ taàm vôùi nhoû nhaát. N68 = -13021 Kg NOÄI LÖÏC CUÛA CAÙC THANH TRONG GIAØN ÑÖÔÏC GHI TOÙM TAÉT TRONG BAÛNG 1: soá kyù Caùc giaù tri löïc ôû caùc taàm vôùi ( Kg ) hieäu thanh Rmax Rtb Rmin N1 -26782 -33440 -42458 N2 -15689 -23407 -11726 N3 4452 34704 11128 N4 -15689 -23407 -11726 N5 -16808 -23353 -30109 N6 -9287 -7308 -1312 N7 943 1777 5321 N8 -24376 -22132 -19328 N9 -17321 -24345 -31748 N10 -8342 -5231 -1947 N11 1511 6783 7332 N12 -31654 -27433 -21258 N13 -12125 -28137 -32339 N14 -10135 -3478 -938 N15 2398 4532 9131 N16 -31122 -23487 -16431 N17 -13141 -28135 -34322 N18 -8751 -6325 -802 N19 1232 8368 9739 N20 -28891 -21743 -11738 N21 -13742 -19432 -28743 N22 -11418 -7132 -4568 N23 5062 17249 28618 N24 -12741 -9122 -4213 N25 -9670 -2366 -1423 N26 -37517 -26432 -21327 soá kyù Giaù trò noäi löïc trong thanh ôû caùc taàm vôùi ( Kg ) hieäu thanh Rmax Rtb Rmin N27 -30124 -24123 -18312 N28 12259 9241 4139 N29 -9669 -2165 -1541 N30 -28623 -18531 -15571 N31 -17312 -21831 -27935 N32 11348 8735 4088 N33 -8541 -3230 -1837 N34 -26135 -17412 -14321 N35 -17121 -22318 -27134 N36 10318 8216 3905 N37 -8132 -4312 -2231 N38 -26022 -17318 -13981 N39 -16987 -21385 -27003 N40 10019 7399 3887 N41 -7837 -4228 -2047 N42 -25319 -16989 -13035 N43 -16198 -20318 -26312 N44 9875 7039 3412 N45 2191 22479 36172 N46 -16357 -30364 -38123 N47 8226 12570 14411 N48 -36311 -38015 -40132 N49 -37151 -30387 -26415 N50 -12541 -10783 -7031 N51 7132 11314 13435 soá kyù Giaù trò noäi löïc trong thanh ôû caùc taàm vôùi ( Kg ) hieäu thanh Rmax Rtb Rmin N52 -31751 -34483 -36148 N53 -34321 -28739 -22987 N54 -12008 -9913 -6548 N55 6973 10759 12312 N56 -29711 -31435 -33258 N57 -31059 -25432 -20793 N58 -11145 -8198 -5451 N59 6033 9347 11258 N60 -25521 -27185 -30177 N61 -29753 -22318 -16587 N62 -9761 -6532 -3411 N63 5178 8132 9030 N64 -20786 -22187 -24121 N65 12385 9783 2030 N66 -20786 -22187 -24121 N67 -11853 -13786 -15428 N68 -13783 -11541 -9035 b).Tính toaùn cho tröôøng hôïp IIb: +). Tính toaùn trong maët phaúng naâng haï caàn: Caùc löïc taùc duïng leân caàn goàm coù: troïng löôïng cuûa haøng vaø thieát bò mang haøng, troïng löôïng baûn thaân caàn, löïc caêng caùp naâng caàn vaø naâng haøng. Trong maët phaúng thaûng ñöùng caàn chuïi taùc duïng cuûa troïng löôïng baûn thaân caàn. Ta xem nhö laø taûi troïng phaân boá leân caùc maét cuûa daøn. Coù 35 maét neân moái maét seû chòu löïc laø: (Kg). Taùch maét 1. å X = 0 Þ N1.cos(+7) + N2.cos(-7) + Rh = 0 å Y = 0 Þ N1.sin(+7) + N2.sin(-7) + Rv –Pc = 0 ÔÛ taàm vôùi lôùn nhaát. N1 = - 28968 N2 = --16974 Kg ÔÛ taàm vôùi trung bình. N1 = - 35129 N2 = -24153 Kg ÔÛ taàm vôùi nhoû nhaát. N1 = - 46785 N2 = -12438 Kg Taùch maét 2. å X = 0 Þ -N2.cos(-7) + N4.cos(-7) = 0 å Y = 0 Þ N2.sin(-7) + sin(-7) + N3 – Pc = 0 ÔÛ taàm vôùi lôùn nhaát. N3 = 4969 N4 = -16982 Kg ÔÛ taàm vôùi trung bình. N3 = 35791 N4 = -24359 Kg ÔÛ taàm vôùi nhoû nhaát. N3 = 12598 N4 = -11981 Kg Taùch maét 3. å X = 0 Þ N5.cos(+7) + N6.cos(-20)-N1.cos(+7) = 0 å Y = 0 Þ N5.sin(+7) + N6.sin(-20)-N1.sin(+7)-Pc = 0 ÔÛ taàm vôùi lôùn nhaát. N5 = -17037 N6 = -10355 Kg ÔÛ taàm vôùi trung bình. N5 = -24158 N6= -7416 Kg ÔÛ taàm vôùi nhoû nhaát. N5 = -31546 N6 = -2099 Kg Taùch maét 4. å X = 0 Þ N7.cos(+31) + N8.cos(-7)-N6.cos(-20)-N4.cos(-7) = 0 å Y = 0 Þ N7.sin(+31) + N8.sin(-7)-N6.sin(-20)- N4.sin(-7)-Pc = 0 ÔÛ taàm vôùi lôùn nhaát. N7 = 1018 N8 = -25678 Kg ÔÛ taàm vôùi trung bình. N7 = 2619 N8= -22456 Kg ÔÛ taàm vôùi nhoû nhaát. N7 = 5983 N8 = -19705 Kg Taùch maét 5. å X = 0 Þ N9.cos(+31) + N10.cos(-40)-N5.cos(+7)-N7.cos(+31) = 0 å Y = 0 Þ N9.sin(+31) - N10.sin(-40)-N5.(+7)-N7.cos(+31)-Pc = 0 ÔÛ taàm vôùi lôùn nhaát. N9 = -18701 Kg N10 = -8918 Kg ÔÛ taàm vôùi trung bình. N9 = -25139 Kg N10 = -5362 Kg ÔÛ taàm vôùi nhoû nhaát. N9= -31936 Kg N10 = -2198 Kg Taùch maét 6. å X = 0 Þ N11.cos(+47) + N12.cos(-7)-N10.cos(+33)-N8.cos(-7) = 0 å Y = 0 Þ N11.sin(+47) - N12.sin(-7)+N10.(+33)+N8.sin(-7)-Pc = 0 ÔÛ taàm vôùi lôùn nhaát. N11 = 2198 Kg N12 = -31980 Kg ÔÛ taàm vôùi trung bình. N11 = 7263 Kg N12 = -28198 Kg ÔÛ taàm vôùi nhoû nhaát. N11 = 8193 Kg N12 = -22637 Kg Taùch maét 7. å X = 0 Þ N13.cos(+7) + N14.cos(-53)-N9.cos(+7)-N11.cos(+40) = 0 å Y = 0 Þ N13.sin(+7) - N14.sin(-53)-N9.(+33)-N11.sin(+40)-Pc = 0 ÔÛ taàm vôùi lôùn nhaát. N13 = -12907 Kg N14 = -10135 Kg ÔÛ taàm vôùi trung bình. N13 = -28703 Kg N14 = -3594 Kg ÔÛ taàm vôùi nhoû nhaát. N13 = -33498 Kg N14 = -1435 Kg Taùch maét 8 å X = 0 Þ N15.cos(+57) + N16.cos(+7)-N14.cos(-53)-N12.cos(-7) = 0 å Y = 0 Þ N15.sin(+57) - N16.sin(+7)+N14.(-53)+N12.sin(-7)-Pc = 0 ÔÛ taàm vôùi lôùn nhaát. N15 = 3154 Kg N16 = -32458 Kg ÔÛ taàm vôùi trung bình. N15 = 5268 Kg N16 = -25104 Kg ÔÛ taàm vôùi nhoû nhaát. N15 = 9437 Kg N16 = -17938 Kg Taùch maét 9. å X = 0 Þ N17.cos(+7) + N18.cos(-67)-N13.cos(+7)-N15.cos(+57) = 0 å Y = 0 ÞN17.sin(+7) - N18.sin(-67)-N13.sin(+7)-N15.sin(+57)-Pc = 0 ÔÛ taàm vôùi lôùn nhaát. N17 = -14539 Kg N18= -9046 Kg ÔÛ taàm vôùi trung bình. N17 = -29253 Kg N18 = -6577 Kg ÔÛ taàm vôùi nhoû nhaát. N17 = -36188 Kg N18 = -1398 Kg Taùch maét 10. å X = 0 Þ N19.cos(+63) + N20.cos(-7)-N18.cos(-61)-N16.cos(-7) = 0 å Y = 0 Þ N19.sin(+63) – N20.sin(+7)+N18.(-61)+N16.sin(-7)-Pc = 0 ÔÛ taàm vôùi lôùn nhaát. N19 = 2971 Kg N20= -29153 Kg ÔÛ taàm vôùi trung bình. N19 = 5792 Kg N20 = -23089 Kg ÔÛ taàm vôùi nhoû nhaát. N19 = 10359 Kg N20 = -13146 Kg Taùch maét 11. å X = 0 Þ N21.cos(+7) + N22.cos(-64)-N17.cos(+7)-N19.cos(+64) = 0 å Y = 0 Þ N21.sin(+7) – N22.sin(-64)-N17.sin(+7)-N19.sin(+64)-Pc = 0 ÔÛ taàm vôùi lôùn nhaát. N21 = -14952 Kg N22= -13097 Kg ÔÛ taàm vôùi trung bình. N21 = -20986 Kg N22 = -8294 Kg ÔÛ taàm vôùi nhoû nhaát. N21 = -30158 Kg N22 = -4926 Kg Taùch maét 12. å X = 0 Þ N24 - N21.cos(+7) = 0 å Y = 0 Þ -N23 - Pc – N21.sin(+7) = 0 ÔÛ taàm vôùi lôùn nhaát. N23 = 6705 Kg N24 = -13145 Kg ÔÛ taàm vôùi trung bình. N23= 19467 Kg N24 = -10973 Kg ÔÛ taàm vôùi nhoû nhaát. N23 = 29918 Kg N24 = -5038 Kg Taùch maét 13. å X = 0 Þ N26 + N25.cos(+66) - N22.cos(-66) - N20.cos(-7) = 0 å Y = 0 Þ N25.sin(+66) + N23 + N22.sin(-66) + N20.sin(-7) = 0 ÔÛ taàm vôùi lôùn nhaát. N25 = -9917 Kg N26 = -39268 Kg ÔÛ taàm vôùi trung bình. N25 = -3294 Kg N26 = -27759 Kg ÔÛ taàm vôùi nhoû nhaát. N25 = - 2173Kg N26 = -22311 Kg Taùch maét 14. å X = 0 Þ N27 –N24+ N28.cos(-67) - N25.cos(+67) = 0 å Y = 0 Þ - N28.sin(-67) - N25.sin(+67) - Pc = 0 ÔÛ taàm vôùi lôùn nhaát. N28 = 14165 Kg N27 = -31933 Kg ÔÛ taàm vôùi trung bình. N28 = 10404 Kg N27 = -26584 Kg ÔÛ taàm vôùi nhoû nhaát. N28 = 5763 Kg N27 = -19446 Kg Taùch maét 15. å X = 0 Þ N30 + N26 - N28.cos(-67) - N29.cos(+67) = 0 å Y = 0 Þ N29.sin(+67) + N28.sin(-67) - Pc = 0 ÔÛ taàm vôùi lôùn nhaát. N30 = -29336 Kg N29 = -11736 Kg ÔÛ taàm vôùi trung bình. N30 = -20463 Kg N29 = -3705 Kg ÔÛ taàm vôùi nhoû nhaát. N30 = -17389 Kg N29 = -2918 Kg Taùch maét 16. å X = 0 Þ N31 –N27 - N32.cos(-67) - N29.cos(+67) = 0 å Y = 0 Þ -N32.sin(-67) - N29.sin(-67) - Pc = 0 ÔÛ taàm vôùi lôùn nhaát. N32 = 12497 Kg N31 = -18952 Kg ÔÛ taàm vôùi trung bình. N32 = 9853 Kg N31 = -22708 Kg ÔÛ taàm vôùi nhoû nhaát. N32 = 5108 Kg N31 = -29194 Kg Taùch maét 17. å X = 0 Þ N34 –N30 - N32.cos(-67) + N33.cos(+67) = 0 å Y = 0 Þ N33.sin(+67) + N32.sin(-67) - Pc = 0 ÔÛ taàm vôùi lôùn nhaát. N33 = -9007 Kg N34 = -28198 Kg ÔÛ taàm vôùi trung bình. N33 = -4658 Kg N34 = -19743 Kg ÔÛ taàm vôùi nhoû nhaát. N33 = -2173 Kg N34 = -16358 Kg Taùch maét 18. å X = 0 Þ N35 –N31 - N33.cos(-67) + N36.cos(+67) = 0 å Y = 0 Þ -N36.sin(-67) – N33.sin(+67) - Pc = 0 ÔÛ taàm vôùi lôùn nhaát. N35 = -19253 Kg N36 = 12745 Kg ÔÛ taàm vôùi trung bình. N35 = -24186 Kg N36 = 9378 Kg ÔÛ taàm vôùi nhoû nhaát. N35 = -29883 Kg N36 = 4851 Kg Taùch maét 19. å X = 0 Þ N38 –N34 - N37.cos(+67) + N36.cos(-67) = 0 å Y = 0 Þ N37.sin(+67) + N36.sin(-67) - Pc = 0 ÔÛ taàm vôùi lôùn nhaát. N38 = -27504 Kg N37 = -9768 Kg ÔÛ taàm vôùi trung bình. N38 = -18457 Kg N37 = -5561 Kg ÔÛ taàm vôùi nhoû nhaát. N38 = -14754 Kg N37 = -3614 Kg Taùch maét 20. å X = 0 Þ N39 –N35 - N40.cos(-67) + N37.cos(+67) = 0 å Y = 0 Þ -N40.sin(-67) – N37.sin(+67) - Pc = 0 ÔÛ taàm vôùi lôùn nhaát. N39 = -17146 Kg N40= 12935 Kg ÔÛ taàm vôùi trung bình. N39 = -22537 Kg N40 = 8673 Kg ÔÛ taàm vôùi nhoû nhaát. N39 = -28674 Kg N40= 4208 Kg Taùch maét 21. å X = 0 Þ N42 –N38 + N41.cos(+67) + N40.cos(-67) = 0 å Y = 0 Þ N37.sin(+67) + N36.sin(-67) - Pc = 0 ÔÛ taàm vôùi lôùn nhaát. N41 = -8676 Kg N42 = -27918 Kg ÔÛ taàm vôùi trung bình. N41= -5913 Kg N42 = -17705 Kg ÔÛ taàm vôùi nhoû nhaát. N41 = -3718 Kg N42 = -14165 Kg Taùch maét 22. å X = 0 Þ N43 –N39 - N41.cos(+67) + N44.cos(-67) = 0 å Y = 0 Þ -N44.sin(-67) – N41.sin(+67) - Pc = 0 ÔÛ taàm vôùi lôùn nhaát. N43 = -18789 Kg N44 = 11784 Kg ÔÛ taàm vôùi trung bình. N43 = -22358 Kg N44 = 9135 Kg ÔÛ taàm vôùi nhoû nhaát. N43 = -27163 Kg N44 = 4638 Kg Taùch maét 23. å X = 0 Þ N46.cos(-7) – N43 = 0 å Y = 0 Þ -N46.sin(-7) – N45 – Pc = 0 ÔÛ taàm vôùi lôùn nhaát. N45 = 3410 Kg N46 = -16357 Kg ÔÛ taàm vôùi trung bình. N45 = 23631 Kg N46 = -32569 Kg ÔÛ taàm vôùi nhoû nhaát. N45 = 38925 Kg N46 = -39947 Kg Taùch maét 24. å X = 0 Þ N47.cos(+66) + N48.cos(+7) – N44.cos(-66) - N42 = 0 å Y = 0 Þ N47.sin(+66) + N48.sin(+7) + N44.sin (-66) + N45-Pc = 0 ÔÛ taàm vôùi lôùn nhaát. N47 = 9168 Kg N48 = -38924 Kg ÔÛ taàm vôùi trung bình. N47 = 14569 Kg N48 = -41705 Kg ÔÛ taàm vôùi nhoû nhaát. N47 = 15914 Kg N48 = -43916 Kg Taùch maét 25. å X = 0 Þ N49.cos(-7) + N50.cos(-64) – N46.cos(-7)-N47.cos(+66) = 0 å Y = 0 Þ-N49.sin(-7) - N50.sin(-64) +N46.sin(-7)-N47.sin(+66)-Pc = 0 ÔÛ taàm vôùi lôùn nhaát. N49 = -38614 Kg N50 = -13620 Kg ÔÛ taàm vôùi trung bình. N49 = -31752 Kg N50 = -11987 Kg ÔÛ taàm vôùi nhoû nhaát. N49 = -27563 Kg N50 = -8932 Kg Taùch maét 26. å X = 0 Þ N52.cos(+7) + N51.cos(+61) – N50.cos(-63)-N48.cos(+7) = 0 å Y = 0 ÞN52.sin(+7) + N51.sin(-64) +N50.sin(-63)-N48.sin(+7)-Pc = 0 ÔÛ taàm vôùi lôùn nhaát. N51 = 8935 Kg N52 = -32546 Kg ÔÛ taàm vôùi trung bình. N51 = 12768 Kg N52 = -35169 Kg ÔÛ taàm vôùi nhoû nhaát. N51 = 14925 Kg N52 = -39763 Kg Taùch maét 27. å X = 0 Þ N53.cos(-7) + N54.cos(-57) – N49.cos(-7)-N51.cos(+61) = 0 å Y = 0 Þ-N53.sin(-7) – N54.sin(-57) +N49.sin(-7)-N51.sin(+61)-Pc = 0 ÔÛ taàm vôùi lôùn nhaát. N53 = -36754 Kg N54 = -14152 Kg ÔÛ taàm vôùi trung bình. N53 = -29984 Kg N54 = -11743 Kg ÔÛ taàm vôùi nhoû nhaát. N53 = -23704 Kg N54 = -7698 Kg Taùch maét 28. å X = 0 Þ N55.cos(+53) + N56.cos(+7) – N52.cos(+7)-N54.cos(-57) = 0 å Y = 0 ÞN55.sin(+53) + N56.sin(+7) -N52.sin(+7)+N54.sin(-57)-Pc = 0 ÔÛ taàm vôùi lôùn nhaát. N55 = 7105 Kg N56 = -31043 Kg ÔÛ taàm vôùi trung bình. N55 = 11689 Kg N56 = -33645 Kg ÔÛ taàm vôùi nhoû nhaát. N55 = 14093 Kg N56 = -36198 Kg Taùch maét 29. å X = 0 Þ N57.cos(-7) + N58.cos(-40) – N53.cos(-7)-N55.cos(+53) = 0 å Y = 0 Þ-N57.sin(-7) – N58.sin(-40) +N53.sin(-7)-N55.sin(+53)-Pc = 0 ÔÛ taàm vôùi lôùn nhaát. N57 = -33195 Kg N58 = -13056 Kg ÔÛ taàm vôùi trung bình. N57 = -27568 Kg N58 = -9235 Kg ÔÛ taàm vôùi nhoû nhaát. N57 = -22937 Kg N58 = -6548 Kg Taùch maét 30. å X = 0 Þ N60.cos(+7) + N59.cos(+33) – N58.cos(-47)-N56.cos(+7) = 0 å Y = 0 ÞN60.sin(+7) + N59.sin(+33) +N58.sin(-47)-N56.sin(+7)-Pc = 0 ÔÛ taàm vôùi lôùn nhaát. N59 = 7894 Kg N60 = -27189 Kg ÔÛ taàm vôùi trung bình. N59 = 11652 Kg N60 = -30452 Kg ÔÛ taàm vôùi nhoû nhaát. N59 = 13986 Kg N60 = -33189 Kg Taùch maét 31. å X = 0 Þ N61.cos(-7) + N62.cos(-31) – N57.cos(-7)-N59.cos(+40) = 0 å Y = 0 Þ-N61.sin(-7) – N562.sin(-31) +N57.sin(-7)-N59.sin(+40)-Pc = 0 ÔÛ taàm vôùi lôùn nhaát. N61 = -30685 Kg N62 = -11698 Kg ÔÛ taàm vôùi trung bình. N61 = -24459 Kg N62 = -8642 Kg ÔÛ taàm vôùi nhoû nhaát. N61 = -17352 Kg N62 = -4199 Kg Taùch maét 32. å X = 0 Þ N64.cos(+7) + N63.cos(+20) – N62.cos(-31)-N60.cos(+7) = 0 å Y = 0 ÞN64.sin(+7) + N63.sin(+33) +N62.sin(-31)-N60.sin(+7)-Pc = 0 ÔÛ taàm vôùi lôùn nhaát. N63 = 6258 Kg N64 = -21989 Kg ÔÛ taàm vôùi trung bình. N63 = 9870 Kg N64 = -23520 Kg ÔÛ taàm vôùi nhoû nhaát. N63 = 10352 Kg N64 = -6481 Kg Taùch maét 33. å X = 0 Þ N66.cos(+7) N64.cos(+7) = 0 å Y = 0 ÞN66.sin(+7) + N65 -N64.sin(+7)-Pc = 0 ÔÛ taàm vôùi lôùn nhaát. N66 = -22986 Kg N65 = 14952 Kg ÔÛ taàm vôùi trung bình. N66 = -25184 Kg N65= 10394 Kg ÔÛ taàm vôùi nhoû nhaát. N66 = -27358 Kg N65 = 3912 Kg Taùch maét 34. å X = 0 Þ N67.cos(-7) - N62.cos(-7)-N63.cos(+20) = 0 ÔÛ taàm vôùi lôùn nhaát. N67 = -12389 Kg ÔÛ taàm vôùi trung bình. N67 = -14576 Kg ÔÛ taàm vôùi nhoû nhaát. N67 = -17358 Kg Taùch maét 35. å Y = 0 Þ N67.sin(-7) - N62.sin(+7)-Pc= 0 ÔÛ taàm vôùi lôùn nhaát. N68 = -16453 Kg ÔÛ taàm vôùi trung bình. N68 = -13981 Kg ÔÛ taàm vôùi nhoû nhaát. N68 = -11952 Kg NOÄI LÖÏC CUÛA CAÙC THANH TRONG GIAØN ÑÖÔÏC GHI TOÙM TAÉT TRONG BAÛNG 2: soá kyù Caùc giaù tri löïc ôû caùc taàm vôùi ( Kg ) hieäu thanh Rmax Rtb Rmin N1 -28785 -35129 -46785 N2 -16974 -24153 -12438 N3 4969 35791 12598 N4 -16982 -24359 -11918 N5 -17037 -24158 -31546 N6 -10355 -7416 -2099 N7 1018 2619 2983 N8 -25678 -22456 -19705 N9 -18701 -25139 -31936 N10 -8918 -5362 -2198 N11 2198 7263 8193 N12 -31980 -28198 -22637 N13 -12907 -28703 -33498 N14 -11362 -3594 -1435 N15 3154 5268 9437 N16 -32458 -25104 -17938 N17 14539 29253 36188 N18 -9046 -6577 -1398 N19 2971 5792 10359 N20 -29153 -23164 -13164 N21 -14952 -20986 -30158 N22 -13097 -8294 -4926 N23 6705 19467 29918 N24 -13145 -10973 -5038 N25 -9917 -3294 -2173 N26 -39268 -27759 -22311 soá kyù Giaù trò noäi löïc trong thanh ôû caùc taàm vôùi ( Kg ) hieäu thanh Rmax Rtb Rmin N27 -31933 -26584 -19446 N28 14165 10404 5763 N29 -11736 -3705 -2918 N30 -29336 -20463 -17389 N31 -18952 -22708 -29194 N32 12497 9853 5108 N33 -9007 -4658 -2173 N34 -28198 -19743 -16358 N35 -19253 -24186 -29553 N36 12745 9378 4851 N37 -9768 -5561 -3614 N38 -27504 -18457 -14754 N39 -17146 -22537 -28674 N40 12935 8673 4208 N41 -8676 -5913 -3718 N42 -27918 -17705 -14165 N43 -18789 -22358 -27163 N44 11784 9135 4638 N45 3410 23631 38925 N46 -17699 -32596 -39947 N47 9168 14569 15914 N48 -38924 -41705 -43916 N49 -38614 -31752 -27563 N50 -13620 -11897 -8932 N51 8935 12768 14952 soá kyù Giaù trò noäi löïc trong thanh ôû caùc taàm vôùi ( Kg ) hieäu thanh Rmax Rtb Rmin N52 -32546 -35169 -39763 N53 -36754 -29984 -23704 N54 -14152 -11743 -7698 N55 7105 11689 14093 N56 -31043 -33645 -36198 N57 -33195 -27568 -22937 N58 -13056 -9235 -6548 N59 7894 11652 13986 N60 -27189 -30452 -33189 N61 -30685 -24459 -17352 N62 -11698 -8642 -4199 N63 6258 9870 10352 N64 -21989 -23520 -26418 N65 14952 10394 3912 N66 -22986 -25184 -27358 N67 -12389 -14576 -17358 N68 -16453 -13918 -11952 +). Tính toaùn trong maët phaúng naèm ngang: Trong maët phaúng naèm ngang sô ñoà tính caàn laø moät thanh ngaøm ñöùng ôû hai ñaàu goái töïa ñuoâi caàu. Taûi troïng taùc duïng bao goàm coù taûi troïng gioù taùc duïng leân caàn Wc, vaø taûi troïng quaùn tính do troïng löôïng caàn gaây ra khi quay caàn truïc Gng, taûi troïng gioù taùc duïng leân haøng. Taûi troïng quaùn tính vaø taûi troïng gioù ñöôïc xem laø caùc taûi troïng phaân boá taùc duïng leân caùc maét cuûa daøn do daøn coù 35 maét neân moãi maét seõ chòu löïc laø: P=[Wc/35 + Gng/35] (Kg). Suy ra P = 32 (Kg) Taùch maét 1. å X = 0 Þ Rng =N1 å Y = 0 Þ N2 = P = 32 Kg ÔÛ taàm vôùi lôùn nhaát. N1 = 15713 Kg ÔÛ taàm vôùi trung bình. N1 = 33588 Kg ÔÛ taàm vôùi nhoû nhaát. N1 = 55950 Kg Taùch maét 2. å Y = 0 Þ P + N2 – N4.sin67 = 0Þ N4 = 64 Kg å X =0 Þ N3 + N4.cos67 – Rng + P = 0 ÔÛ taàm vôùi lôùn nhaát. N3 = 15683 Kg ÔÛ taàm vôùi trung bình. N3 = 33588 Kg ÔÛ taàm vôùi nhoû nhaát. N3 = 55918 Kg Taùch maét 3. å X = 0 Þ N6 + N5.cos67-N4.cos-N1 = 0 å Y =0 Þ N5.sin67 + N4.sin67 + P = 0 Þ N5 = 98 Kg ÔÛ taàm vôùi lôùn nhaát. N6 = 15695 Kg ÔÛ taàm vôùi trung bình. N6 = 33570 Kg ÔÛ taàm vôùi nhoû nhaát. N6 = 55932 Kg Taùch maét 4. å X = 0 Þ N7 + N8.cos67 – N5.cos67 – N3 = 0 å Y =0 Þ -N8.sin67 – N5.sin67 + P = 0 ÞN8 = -132 Kg ÔÛ taàm vôùi lôùn nhaát. N7 = 15551 Kg ÔÛ taàm vôùi trung bình. N7 = 33443 Kg ÔÛ taàm vôùi nhoû nhaát. N7 = 55786 Kg Taùch maét 5. å X = 0 Þ N10 + N9.cos67-N8.cos-N6 = 0 å Y =0 Þ N9.sin67 + N8.sin67 + P = 0 Þ N9 = 160 Kg ÔÛ taàm vôùi lôùn nhaát. N10 =15368 Kg ÔÛ taàm vôùi trung bình. N10 = 33209 Kg ÔÛ taàm vôùi nhoû nhaát. N10 = 55432 Kg Taùch maét 6. å X = 0 Þ N11 + N12.cos67 – N9.cos67 – N7 = 0 å Y =0 Þ -N12.sin67 – N9.sin67 + P = 0 ÞN12 = -132 Kg ÔÛ taàm vôùi lôùn nhaát. N11 = 15162 Kg ÔÛ taàm vôùi trung bình. N11 = 33098 Kg ÔÛ taàm vôùi nhoû nhaát. N11 = 55213 Kg Taùch maét 7. å X = 0 Þ N14 + N13.cos67-N12.cos-N10 = 0 å Y =0 Þ N13.sin67 + N14.sin67 + P = 0 Þ N13 = 205 Kg ÔÛ taàm vôùi lôùn nhaát. N14 = 14936 Kg ÔÛ taàm vôùi trung bình. N14 = 32863 Kg ÔÛ taàm vôùi nhoû nhaát. N14 = 54918 Kg Taùch maét 8. å X = 0 Þ N15 + N16.cos67 – N13.cos67 – N11 = 0 å Y =0 Þ -N16.sin67 – N13.sin67 + P = 0 Þ N16 = -231 Kg ÔÛ taàm vôùi lôùn nhaát. N15 = 14718 Kg ÔÛ taàm vôùi trung bình. N15 = 32651 Kg ÔÛ taàm vôùi nhoû nhaát. N15 = 54792 Kg Taùch maét 9. å X = 0 Þ N18 + N17.cos67-N16.cos-N14 = 0 å Y =0 Þ N17.sin67 + N16.sin67 + P = 0 Þ N17 = 267 Kg ÔÛ taàm vôùi lôùn nhaát. N18 = 14452 Kg ÔÛ taàm vôùi trung bình. N18 = 32389 Kg ÔÛ taàm vôùi nhoû nhaát. N18 = 54453 Kg Taùch maét 10. å X = 0 Þ N20 = N18 å Y =0 Þ N19 = P = 32 Kg ÔÛ taàm vôùi lôùn nhaát. N20 = 14452 Kg ÔÛ taàm vôùi trung bình. N20 = 32389 Kg ÔÛ taàm vôùi nhoû nhaát. N20 = 54453 Kg Taùch maét 11. å X = 0 Þ N21 + N22.cos67-N17.cos67-N15 = 0 å Y =0 Þ -N22.sin67 – N17.sin67 + P – N19 = 0 Þ N22 = -301 Kg ÔÛ taàm vôùi lôùn nhaát. N21 = 14135 Kg ÔÛ taàm vôùi trung bình. N21 = 31998 Kg ÔÛ taàm vôùi nhoû nhaát. N21 = 54162 Kg Taùch maét 12. å X = 0 Þ N24 + N23.cos67-N22.cos-N20 = 0 å Y =0 Þ N23.sin67 + N22.sin67 + P = 0 Þ N23 = 324 Kg ÔÛ taàm vôùi lôùn nhaát. N24 =13755 Kg ÔÛ taàm vôùi trung bình. N24 = 31689 Kg ÔÛ taàm vôùi nhoû nhaát. N24 = 53896 Kg Taùch maét 13. å X = 0 Þ N25 + N26.cos67 – N23.cos67 – N21 = 0 å Y =0 Þ -N26.sin67 – N23.sin67 + P = 0 Þ N26 = -336 Kg ÔÛ taàm vôùi lôùn nhaát. N25 = 13423 Kg ÔÛ taàm vôùi trung bình. N25 = 31291 Kg ÔÛ taàm vôùi nhoû nhaát. N25 = 53452 Kg Taùch maét 14. å X = 0 Þ N28 + N27.cos67-N26.cos-N24 = 0 å Y =0 Þ N27.sin67 + N26.sin67 + P = 0 Þ N27 = 359 Kg ÔÛ taàm vôùi lôùn nhaát. N28 = 13048 Kg ÔÛ taàm vôùi trung bình. N28 = 30852 Kg ÔÛ taàm vôùi nhoû nhaát. N28 = 53138 Kg Taùch maét 15. å X = 0 Þ N29 + N30.cos67 – N27.cos67 – N25 = 0 å Y =0 Þ -N30.sin67 – N27.sin67 + P = 0 Þ N30 = -382 Kg ÔÛ taàm vôùi lôùn nhaát. N29 = 12862 Kg ÔÛ taàm vôùi trung bình. N29 = 30549 Kg ÔÛ taàm vôùi nhoû nhaát. N29 = 52773 Kg Taùch maét 16. å X = 0 Þ N32 + N31.cos67-N30.cos-N28 = 0 å Y =0 Þ N31.sin67 + N30.sin67 + P = 0 Þ N31 = 403 Kg ÔÛ taàm vôùi lôùn nhaát. N32 = 12458 Kg ÔÛ taàm vôùi trung bình. N32 = 29794 Kg ÔÛ taàm vôùi nhoû nhaát. N32 = 52397 Kg Taùch maét 17. å X = 0 Þ N33 + N34.cos67 – N31.cos67 – N29 = 0 å Y =0 Þ -N34.sin67 – N31.sin67 + P = 0 Þ N34 = -437 Kg ÔÛ taàm vôùi lôùn nhaát. N33 = 12003 Kg ÔÛ taàm vôùi trung bình. N33 = 29794 Kg ÔÛ taàm vôùi nhoû nhaát. N33 = 51896 Kg Taùch maét 18. å X = 0 Þ N36 + N35.cos67-N34.cos-N32 = 0 å Y =0 Þ N35.sin67 + N34.sin67 + P = 0 Þ N35 = 468 Kg ÔÛ taàm vôùi lôùn nhaát. N36 = 11654 Kg ÔÛ taàm vôùi trung bình. N36 = 29352 Kg ÔÛ taàm vôùi nhoû nhaát. N36 = 51451 Kg Taùch maét 19. å X = 0 Þ N37 + N38.cos67 – N35.cos67 – N33 = 0 å Y =0 Þ -N38.sin67 – N35.sin67 + P = 0 Þ N38 = -491 Kg ÔÛ taàm vôùi lôùn nhaát. N37 = 11132 Kg ÔÛ taàm vôùi trung bình. N37 = 28976 Kg ÔÛ taàm vôùi nhoû nhaát. N37 = 51009 Kg Taùch maét 20. å X = 0 Þ N40 + N39.cos67-N38.cos-N36 = 0 å Y =0 Þ N39.sin67 + N38.sin67 + P = 0 Þ N39 = 523 Kg ÔÛ taàm vôùi lôùn nhaát. N40 = 10792 Kg ÔÛ taàm vôùi trung bình. N40 = 28381 Kg ÔÛ taàm vôùi nhoû nhaát. N40 = 50652 Kg Taùch maét 21. å X = 0 Þ -N40 + N42.cos67 = 0 å Y =0 Þ N42.sin7 + N41 + P = 0 ÔÛ taàm vôùi lôùn nhaát. N41 = -1357 Kg N42 = 10873 Kg ÔÛ taàm vôùi trung bình. N41 = -3516 Kg N42 = 28594 Kg ÔÛ taàm vôùi nhoû nhaát. N41 = -6251 Kg N42 = 51032 Kg Taùch maét 22. å X = 0 Þ N43.cos7 + N44.cos66-N37-N39.cos66 = 0 å Y =0 Þ -N43.sin7 - N44.sin66 – N41 – N39.sin66 + P = 0 ÔÛ taàm vôùi lôùn nhaát. N43 = 11677 Kg N44 = -784 Kg ÔÛ taàm vôùi trung bình. N43 = 29763 Kg N44 = -2318 Kg ÔÛ taàm vôùi nhoû nhaát. N43 = 53918 Kg N44 = -4166 Kg Taùch maét 23. å X = 0 Þ N46.cos7 + N45.cos64-N44.cos66-N42.cos7 = 0 å Y =0 Þ N46.sin7 + N45.sin64 +N44.sin66 – N42.sin7 + P = 0 ÔÛ taàm vôùi lôùn nhaát. N45 = 752 Kg N46 = 10589 Kg ÔÛ taàm vôùi trung bình. N45 = 2164 Kg N46 = 27951 Kg ÔÛ taàm vôùi nhoû nhaát. N45 = 4055 Kg N46 = 51703 Kg Taùch maét 24. å X = 0 Þ N47.cos7 + N48.cos61-N45.cos63-N43.cos7 = 0 å Y =0 Þ -N47.sin7 - N48.sin61 – N45.sin63 + N43.sin7 + P = 0 ÔÛ taàm vôùi lôùn nhaát. N47 = 9753 Kg N48 = -652 Kg ÔÛ taàm vôùi trung bình. N47 = 25389 Kg N48 = -1975 Kg ÔÛ taàm vôùi nhoû nhaát. N47 = 48763 Kg N48 = -3968 Kg Taùch maét 25. å X = 0 Þ N50.cos7 + N49.cos57-N48.cos61-N46.cos7 = 0 å Y =0 Þ N50.sin7 + N49.sin57 +N48.sin61 – N46sin7+ P = 0 ÔÛ taàm vôùi lôùn nhaát. N49 = 691 Kg N50 =9176 Kg ÔÛ taàm vôùi trung bình. N49= 2286 Kg N50 = 23914 Kg ÔÛ taàm vôùi nhoû nhaát. N49= 3917 Kg N50 = 45621 Kg Taùch maét 26. å X = 0 Þ N51.cos7 + N52.cos53-N49.cos57-N47.cos7 = 0 å Y =0 Þ -N51.sin7 – N52.sin53 – N49.sin57 + N47.sin7 + P = 0 ÔÛ taàm vôùi lôùn nhaát. N51 = 7846 Kg N52 = -605 Kg ÔÛ taàm vôùi trung bình. N51 = 21052 Kg N52 = -2018 Kg ÔÛ taàm vôùi nhoû nhaát. N51 = 42697 Kg N52 = -3765 Kg Taùch maét 27. å X = 0 Þ N54.cos7 + N53.cos40-N52.cos53-N50.cos7 = 0 å Y =0 Þ N54.sin7 + N53.sin40 + N52.sin53 – N50.sin7 + P = 0 ÔÛ taàm vôùi lôùn nhaát. N53 = 519 Kg N54 = 6978 Kg ÔÛ taàm vôùi trung bình. N54 = 1864 Kg N54 = 19578 Kg ÔÛ taàm vôùi nhoû nhaát. N54 = 3414 Kg N54 = 40652 Kg Taùch maét 28. å X = 0 Þ N55.cos7 + N56.cos33-N53.cos47-N51.cos7 = 0 å Y =0 Þ -N55.sin7 – N56.sin33 – N53.sin47 + N51.sin7 + P = 0 ÔÛ taàm vôùi lôùn nhaát. N55 = 6035 Kg N56 = -469 Kg ÔÛ taàm vôùi trung bình. N55 = 17592 Kg N56 = -1532 Kg ÔÛ taàm vôùi nhoû nhaát. N55 = 37184 Kg N56 = -3168 Kg Taùch maét 29. å X = 0 Þ N58.cos7 + N57.cos31-N56.cos40-N54.cos7 = 0 å Y =0 Þ N58.sin7 + N57.sin31 + N56.sin40 – N54.sin7 + P = 0 ÔÛ taàm vôùi lôùn nhaát. N57 =405 Kg N58 = 5763 Kg ÔÛ taàm vôùi trung bình. N57 = 1469 Kg N58 = 14789 Kg ÔÛ taàm vôùi nhoû nhaát. N57 = 2976 Kg N58 = 34152 Kg Taùch maét 30. å X = 0 Þ N59.cos7 + N60.cos20-N57.cos31-N55.cos7 = 0 å Y =0 Þ -N59.sin7 – N60.sin20 – N57.sin31 + N55.sin7 + P = 0 ÔÛ taàm vôùi lôùn nhaát. N59 = 4518 Kg N60 = -375 Kg ÔÛ taàm vôùi trung bình. N59 = 12653 Kg N60 = -1294 Kg ÔÛ taàm vôùi nhoû nhaát. N59 = 30189 Kg N60 = -2617 Kg Taùch maét 31. å X = 0 Þ N61.cos7 – N59.cos 7 – N57.cos13 = 0 ÔÛ taàm vôùi lôùn nhaát. N61 = 2130 Kg ÔÛ taàm vôùi trung bình. N61 = 7783 Kg ÔÛ taàm vôùi nhoû nhaát. N61 = 16982 Kg Taùch maét 32. ÔÛ taàm vôùi lôùn nhaát. N62 = 2018 Kg ÔÛ taàm vôùi trung bình. N62 = 7652 Kg ÔÛ taàm vôùi nhoû nhaát. N62 = 15783 Kg Noäi löïc tính ñöôïc trong caùc thanh trong daøn ôû maët phaúng ngangï ñöôïc ghi trong baûng 3: soá kyù Caùc giaù tri löïc ôû caùc taàm vôùi ( Kg ) hieäu thanh Rmax Rtb Rmin N1 15713 33588 55950 N2 32 32 32 N3 15683 33575 55918 N4 64 64 64 N5 98 98 98 N6 15695 33570 55932 N7 15551 33443 55786 N8 -132 -132 -132 N9 160 160 160 N10 15368 33209 55432 N11 15162 32098 55213 N12 -189 -189 -189 N13 205 205 205 N14 14936 32863 54918 N15 14718 32651 54792 N16 -231 -231 -231 N17 267 267 267 N18 14452 32389 54453 N19 32 32 32 N20 14452 32389 54453 N21 14135 31998 54162 N22 -301 -301 -301 N23 324 324 324 N24 13755 31689 53896 N25 13423 31291 53452 N26 -336 -336 -336 soá kyù Giaù trò noäi löïc trong thanh ôû caùc taàm vôùi ( Kg ) hieäu thanh Rmax Rtb Rmin N27 359 359 359 N28 13048 30852 53138 N29 12862 30549 52773 N30 -382 -382 -382 N31 403 403 403 N32 12458 30186 52397 N33 12003 29794 51896 N34 -437 -437 -437 N35 468 468 468 N36 11654 29352 51451 N37 11132 28976 51009 N38 -491 -491 -491 N39 523 523 523 N40 10792 28381 50652 N41 -1357 -3516 -6251 N42 10873 28594 51032 N43 11674 29763 53918 N44 -784 -2318 -4166 N45 1752 2164 4055 N46 10589 27951 51763 N47 9753 25389 48763 N48 -652 -1975 -3968 N49 691 2286 3917 N50 9176 23914 45621 N51 7846 21052 42697 soá kyù Giaù trò noäi löïc trong thanh ôû caùc taàm vôùi ( Kg ) hieäu thanh Rmax Rtb Rmin N52 -605 -2018 -3765 N53 519 1864 3414 N54 6978 19578 40652 N55 6035 17592 37184 N56 -469 -1532 -3168 N57 405 1469 2976 N58 5763 14798 34152 N59 4518 12653 30189 N60 -375 -1294 -2617 N61 2130 7783 16982 N62 2018 7652 15783 VI). Choïn vaø kieåm tra caùc thaønh phaàn cuûa caàn: 1. Thanh bieân: Choïn tieát dieän cho caùc thanh bieân treân, qua tính toaùn ta nhaän thaáy raèng cuøng moät thanh bieân ôû trong maët phaúng naèm ngang thì chòu keùo coøn trong maët phaúng naâng haï thì laïi chòu neùn do ñoù noäi löïc trong caùc thanh bieân ñöôïc xaùc ñònh baèng toång noäi löïc ôû caùc thanh tìm ñöôïc trong maët phaúng naâng haï vaø maët phaúng naèm ngang töông öùng. Qua tính toaùn ta thaáy: Noäi löïc trong thanh bieân ôû ñuoâi caàn laø lôùn nhaát vaø chòu neùùn ôû taàm vôùi nhoû nhaát giaù trò tính ñöôïc laø: Nmax = N1(mp ngang) + N2(mp naâng haï) = 55950 – 16970 = 38976 Nmax = 38976 (Kg) Vaäy tieát dieän caùc thanh bieân trong daøn ñöôïc choïn theo thanh coù noäi löïc lôùn nhaát vaø tieát dieän ñöôïc choïn sao cho ñaûm baûo ñuû ñoä beàn vaø oån ñònh Thanh chòu taûi lôùn nhaát laø thanh bieân ñuoâi caàn: theùp CT3 Chieàu daøi tính cuûa thanh: l = 50 cm. Choïn ñoä maûnh cuûa thanh l = 30. Tra baûng 7.2 Þ j = 0,92 Tieát dieän caàn thieát cuûa thanh theo ñieàu kieän beàn vaø oån ñònh, coâng thöùc: Vôùi ñieàu kieän nhö theá cho pheùp ta choïn tieát dieän thanh bieân laø theùp goùc ñeàu caïnh No=10(110x7x12) theo tieâu chuaån GOCT 8509 – 57 (Baûng 3 ) coù caùc thoâng soá sau: ® Dieän tích maët caét: Fb = 15,2 cm2. ® Troïng löôïng 1m daøi: mb = 119 N/m ® Moâmen quaùn tính ñoái vôùi truïc x – x: Jxb = 176 cm4. ® Baùn kính quaùn tính ñoái vôùi truïc x – x: rx = 3,4 cm. ® Moâmen quaùn tính ñoái vôùi truïc xo – xo: Jxob = 279 cm4. ® Baùn kính quaùn tính ñoái vôùi truïc xo – xo: rxob = 4,29 cm. ® Moâ men quaùn tính ñoái vôùi truïc yo – yo: Jyominb = 727 cm4. ® Moâ men quaùn tính ñoái vôùi truïc x1 – x1: Jx1b = 308 cm4. ® Khoaûng caùch töø heä toïa ñoä xCy ñeán thaønh beân cuûa theùp: zob = 2,96 cm. ( thoaû maõn ñieàu kieän beàn vaø oån ñònh) Thöû laïi ta coù =1860 (Kg/cm) Vaäy vôùi theùp goùc caïnh ñeàu ñaõ choïn thì thanh laøm vieäc oån ñònh Ñeå giaûm soá loaïi theùp khi mua ta choïn taát caû caùc tieát dieän thanh bieân ñeàu baèng theùp goùc ñeàu caïnh No 11037312. 2. Thanh giaèng: Tieát dieän thanh giaèng choïn theo ñoát chòu taûi lôùn nhaát ñoù laø thanh 47 N47 = 15914 (Kg) _ Chieàu daøi tính cuûa thanh: giaû söû = 0,6 l = 130 mm. Tieát dieän caàn thieát cuûa thanh theo ñieàu kieän beàn vaø oån ñònh, coâng thöùc: Vôùi ñieàu kieän treân tra baûng 3 [8] choïn tieát dieän caùc thanh giaèng cheùo ñöùng vaø giaèng cheùo ngang cuõng laø theùp goùc ñeàu caïnh ñeå giaûm soá löôïng loaïi theùp khi mua, vôùi soá hieäu theùp No =5(503435,5) theo tieâu chuaån GOCT 8509 – 57 (Baûng 3 [8]) coù caùc thoâng soá sau: ® Dieän tích maët caét: Fg = 3,98 cm2. ® Troïng löôïng 1m daøi: mg = 3,05 N. ® Moâmen quaùn tính ñoái vôùi truïc x – x: Jxg = 9,21 cm4. ® Baùn kính quaùn tính ñoái vôùi truïc x – x: rx = 1,54 cm. ® Moâmen quaùn tính ñoái vôùi truïc xo – xo: Jxomax-g = 14,6 cm4. ® Baùn kính quaùn tính ñoái vôùi truïc xo – xo: rxomax = 1,94 cm. ® Moâ men quaùn tính ñoái vôùi truïc yo – yo: Jyomin-g = 3,8 cm4. ® Moâ men quaùn tính ñoái vôùi truïc x1 – x1: Jx1g = 16,6 cm4. ® Khoaûng caùch töø heä toïa ñoä xCy ñeán thaønh beân cuûa theùp:zog = 1,38cm. _ Baùn kính quaùn tính nhoû nhaát: _ Ñoä maûnh cuûa thanh: Vôùi l = 83,2 tra baûng 7.2 choïn heä soá giaûm öùng suaát cho pheùp j = 0,71 _ Ñoä oån ñònh cuûa thanh ñöôïc kieåm tra theo coâng thöùc : (Kg/cm) Thoûa maõn ñieàu kieän oån ñònh. VII). Kieåm tra oån ñònh cuûa caàn: Caàn laø moät thanh toå hôïp chòu neùn neân caàn thieát phaûi kieåm tra oån ñònh keát caáu kim loaïi cuûa caàn. Trong ñoù: v j: heä soá giaûm öùng suaát phuï thuoäc vaøo ñoä maûnh töông ñöông _ ltñ cuûa thanh toå hôïp: _ Trong maët phaúng naâng haøng: caàn laø moät thanh toå hôïp coù hai ñaàu lieân keát khôùp neân: m = 1 lx = m3m13l ® m1: heä soá phuï thuoäc vaøo tyû soá vaø hình daùng caàn. ® m: heä soá phuï thuoäc vaøo lieân keát thanh. ® l: chieàu daøi caàn l = 15m. _ Trong maët phaúng ngang: caàn laø moät thanh congxon coù lieân keát ngaøm cöùng ôû hai ñaàu: m = 2 ly = m3m13l * Tính moâmen quaùn tính: ® Fb: dieän tích tieát dieän thanh bieân (Fb = 15,2cm2 ) ® Zo: khoaûng caùch töø ñöôøng taâm hình hoïc cuûa theùp ñeán thaønh beân cuûa noù. ® C1 (2,96; 2,96): toaï ñoä cuûa dieän tích F1 vôùi truïc xOy. ® C2 (2,96; 117,04): toaï ñoä cuûa dieän tích F2 vôùi truïc xOy. ® C3 (117,04; 117,04): toaï ñoä cuûa dieän tích F3 vôùi truïc xOy. ® C4 (117,04; 2,96): toaï ñoä cuûa dieän tích F4 vôùi truïc xOy. + Xaùc ñònh toaï ñoä troïng taâm C: Vì: F1 = F2 = F3 = F4 = Fb neân: Töông töï: + Tính moâmen quaùn tính chính trung taâm: Vì: F = F1 + F2 + F3 + F4 neân ta coù: Trong ñoù: ® : laàn löôït laø moâmen quaùn tính cuûa dieän tích F1, F2, F3, F4 ñoái vôùi truïc X. ® : laàn löôït laø moâmen quaùn tính cuûa dieän tích F1, F2, F3, F4 ñoái vôùi truïc Y. Vaäy: Trong maët phaúng naâng haøng vôùi = 1 Þ m1 = 1 tra baûng 7.5 . Lx = 1.1.15 = 15 (m) Trong maët phaúng ngang vôùi tyû soá = 1 tra baûng 7.5:Þ m= 1 Þ ly = 231315 = 30 (m). Ñoä maûnh töông ñöông cuûa caàn: Trong ñoù: ® Fb: dieän tích tieát dieän thanh bieân Fb = 22,8 (cm2) ® Fg: dieän tích tieát dieän thanh giaèng: Fg1 = Fg2 = Fg = (12,3 cm2) ® k1 vaø k2: heä soá phuï thuoäc goùc nghieâng cuûa thanh giaèng so vôùi thanh bieân + Vôùi goùc nghieâng a =45o - 70o Þ k1= k2 = 27. ® lmax: ñoä maûnh lôùn nhaát cuûa caàn: lmax = 132 Vaäy: Vôùi ltñ = 132,79 tra baûng 7.2 Þ heä soá giaûm öùng suaát cho pheùp j = 0,32 v F: toång dieän tích maët caét cuûa tieát dieän thanh: F = 4Fb + 4Fg = 4315,2 +433,89 = 76,36 cm2. v N: löïc neùn ôû ñaàu caàn töông öùng vôùi taàm vôùi nhoû nhaát:N = 16453 (Kg). Vaäy caàn thoaõ maõn veà ñieàu kieän oån ñònh. VIII). Tính moái gheùp haøn Caùc moái gheùp haøn ñöôïc tính theo öùng suaát cho pheùp. Trò soá caùc öùng suaát cho pheùp cuûa moái haøn chòu taûi troïng tónh phuï thuoäc vaøo keát caáu moái haøn, loaïi löïc taùc duïng, loaïi que haøn vaø phöông phaùp haøn. Choïn phöông phaùp haøn choàng, moái haøn hoãn hôïp cho keát caáu theùp cuûa loaïi daøn naøy. Chieàu daøy moái haøn choàng laáy theo coâng thöùc (7.6) [1]: d = h3K Trong ñoù: ® K: chieàu roäng caïnh haøn. ® h: heä soá phuï thuoäc phöông phaùp haøn. Choïn phöông phaùp haøn baèng tay Þ h = 0,7. K d Vaäy: d = 0,7310 = 7 mm. Vì ñaây laø theùp goùc _ coù tieát dieän khoâng ñoái xöùng, löïc N phaân boá ñeàu cho caùc moái haøn theo tyû leä nghòch vôùi khoaûng caùch e1, e2 (ñeå ñaûm baûo caùc moái haøn laøm vieäc nhö nhau): theo coâng thöùc (7-13) [1] ; Trong ñoù: ® e1, e2: khoaûng caùc töø ñöôøng truïc cuûa thanh bieân ñeán moái haøn. ® b: chieàu roäng thanh. Caùc moái haøn 1 vaø 2 ñöôïc tính theo taûi troïng N1 vaø N2 töông öùng. Do ñoù giöõa chieàu e1 vaø e2 cuûa moái haøn 1 vaø 2 coù heä thöùc (7.14) [1]: Vôùi theùp goùc ñeàu caïnh: l1 = 0.6lh ; l2 = 0,4lh ® lh= 100: toång chieàu daøi ñöôøng haøn. _ Ñieàu kieän ñaûm baûo söùc beàn ñeàu cuûa hai moái haøn laø öùng suaát sinh ra trong caùc moái haøn seõ baèng nhau vaø xaùc ñònh theo coâng thöùc (7.15) [1]: Trong ñoù: ® N: löïc doïc trong thanh N = 38976 (Kg). ® [t]: öùng suaát caét cho pheùp cuûa vaät lieäu. [t] = 0,6[s]k = (964108)N/mm2. + [s]k : öùng suaát keùo cuûa vaät lieäu laøm que haøn. MUÏC LUÏC I).Giôùi thieäu chung. 1 1).Giôùi thieäu veà keát caáu theùp caàn truïc thieát keá 1 2).Caùc thoâng soá cô baûn 1 3).Hình thöùc keát caáu 2 4).Caùc thoâng soá cuûa keát caáu theùp caàn 2 II).Caùc toå hôïp taûi troïng 2 III).Toå hôïp taûi troïng vaø baûng toå hôïp taûi troïng 3 1).Toå hôïp taûi troïng 3 2).Baûng toå hôïp taûi troïng 4 IV).Caùc taûi troïng tính toaùn 4 1).Tröôøng hôïp taûi troïng IIa 4 2). Tröôøng hôïp taûi troïng IIb 8 3).Bieåu ñoà noäi löïc döôùi taùc duïng cuûa troïng löôïng baûn thaân caàn 14 V).Xaùc ñònh noäi löïc caùc thanh trong daøn 14 1) Khaùi nieäm 14 2)Tính noäi löïc trong daøn baèng phöông phaùp taùch maét 15 VI).Tính choïn vaø kieåm tra caùc thaønh phaàn cuûa caàn 61 1).Thanh bieân 61 2).Thanh giaèng 62 VII).Kieåm tra oån ñònh cuûa caàn 63 VIII).Tính moái gheùp haøn 66 Muïc luïc 68

Các file đính kèm theo tài liệu này:

  • docket cau thep - minh duc.doc
  • dwgban ve tong the.dwg
  • docbia.doc
  • dwgCONG TRUC 2 DAM.dwg
  • dwgin.dwg
  • dwgkct-minhduc.dwg
  • dwlkct-minhduc.dwl
  • docket cau thep - minh duc1.doc
  • dbThumbs.db